C13H15NO2 — CID 91507829
4-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)butanal (PubChem CID 91507829) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)butanal.
| Compound Name | 4-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)butanal |
|---|---|
| PubChem CID | 91507829 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)butanal |
| SMILES | O=CCCCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C13H15NO2/c15-9-5-4-8-12-10-13(14-16-12)11-6-2-1-3-7-11/h1-3,6-7,9-10,12,14H,4-5,8H2 |
| InChIKey | KVCTVBAVWCNNPR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|