C19H17F3N2 — CID 90815150
9-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-1-amine (PubChem CID 90815150) has the molecular formula C19H17F3N2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 9-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-1-amine.
| Compound Name | 9-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-1-amine |
|---|---|
| PubChem CID | 90815150 |
| Molecular Formula | C19H17F3N2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 9-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydrocarbazol-1-amine |
| SMILES | NC1CCCc2c1n(-c1ccccc1)c1ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H17F3N2/c20-19(21,22)12-9-10-17-15(11-12)14-7-4-8-16(23)18(14)24(17)13-5-2-1-3-6-13/h1-3,5-6,9-11,16H,4,7-8,23H2 |
| InChIKey | DOUMOMYDPPFJCZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |