C5H8N2S2 — CID 90818653
2-(disulfanyl)-5-methyl-4,5-dihydropyrimidine (PubChem CID 90818653) has the molecular formula C5H8N2S2 and a molecular weight of 160.27 g/mol. Its IUPAC name is 2-(disulfanyl)-5-methyl-4,5-dihydropyrimidine.
| Compound Name | 2-(disulfanyl)-5-methyl-4,5-dihydropyrimidine |
|---|---|
| PubChem CID | 90818653 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 2-(disulfanyl)-5-methyl-4,5-dihydropyrimidine |
| SMILES | CC1C=NC(SS)=NC1 |
| InChI | InChI=1S/C5H8N2S2/c1-4-2-6-5(9-8)7-3-4/h2,4,8H,3H2,1H3 |
| InChIKey | RCUSYCZLUNLRNG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|