C19H14N4O3S — CID 90820162
methyl 4-formamido-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 90820162) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is methyl 4-formamido-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-formamido-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 90820162 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | methyl 4-formamido-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccc(-c3cn4ccccc4n3)cc2)nc1NC=O |
| InChI | InChI=1S/C19H14N4O3S/c1-26-19(25)16-17(20-11-24)22-18(27-16)13-7-5-12(6-8-13)14-10-23-9-3-2-4-15(23)21-14/h2-11H,1H3,(H,20,24) |
| InChIKey | HHDNEWRXZHEWCO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|