C15H20N2O6 — CID 90820823
5-O-(2,5-dihydroxypyrrol-1-yl) 1-O-hex-5-ynyl 2-aminopentanedioate (PubChem CID 90820823) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-O-(2,5-dihydroxypyrrol-1-yl) 1-O-hex-5-ynyl 2-aminopentanedioate.
| Compound Name | 5-O-(2,5-dihydroxypyrrol-1-yl) 1-O-hex-5-ynyl 2-aminopentanedioate |
|---|---|
| PubChem CID | 90820823 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 5-O-(2,5-dihydroxypyrrol-1-yl) 1-O-hex-5-ynyl 2-aminopentanedioate |
| SMILES | C#CCCCCOC(=O)C(N)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H20N2O6/c1-2-3-4-5-10-22-15(21)11(16)6-9-14(20)23-17-12(18)7-8-13(17)19/h1,7-8,11,18-19H,3-6,9-10,16H2 |
| InChIKey | CDJUWYNNUPBDIJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|