C10H16N2O4 — CID 54261889
(2,5-dihydroxypyrrol-1-yl) (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 54261889) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 54261889 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H16N2O4/c1-3-6(2)9(11)10(15)16-12-7(13)4-5-8(12)14/h4-6,9,13-14H,3,11H2,1-2H3/t6-,9-/m0/s1 |
| InChIKey | RECHDSMCTPHGPN-RCOVLWMOSA-N |
| XLogP | 0.23 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |