C19H35NO4S — CID 90823831
methyl (Z)-hept-5-enoate;(1R,2S,4S)-2-methyl-3-(propoxysulfinylamino)bicyclo[2.2.1]heptane (PubChem CID 90823831) has the molecular formula C19H35NO4S and a molecular weight of 373.56 g/mol. Its IUPAC name is methyl (Z)-hept-5-enoate;(1R,2S,4S)-2-methyl-3-(propoxysulfinylamino)bicyclo[2.2.1]heptane.
| Compound Name | methyl (Z)-hept-5-enoate;(1R,2S,4S)-2-methyl-3-(propoxysulfinylamino)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 90823831 |
| Molecular Formula | C19H35NO4S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | methyl (Z)-hept-5-enoate;(1R,2S,4S)-2-methyl-3-(propoxysulfinylamino)bicyclo[2.2.1]heptane |
| SMILES | C/C=C\CCCC(=O)OC.CCCOS(=O)NC1[C@H]2CC[C@H](C2)[C@@H]1C |
| InChI | InChI=1S/C11H21NO2S.C8H14O2/c1-3-6-14-15(13)12-11-8(2)9-4-5-10(11)7-9;1-3-4-5-6-7-8(9)10-2/h8-12H,3-7H2,1-2H3;3-4H,5-7H2,1-2H3/b;4-3-/t8-,9+,10-,11?,15?;/m0./s1 |
| InChIKey | VTFMNENXUNPLNU-ODCUMYEVSA-N |
| XLogP | 3.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|