C10H20NO4P — CID 90826851
1-[methyl(prop-2-enoyl)amino]hexan-3-ylphosphonic acid (PubChem CID 90826851) has the molecular formula C10H20NO4P and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-[methyl(prop-2-enoyl)amino]hexan-3-ylphosphonic acid.
| Compound Name | 1-[methyl(prop-2-enoyl)amino]hexan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 90826851 |
| Molecular Formula | C10H20NO4P |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-[methyl(prop-2-enoyl)amino]hexan-3-ylphosphonic acid |
| SMILES | C=CC(=O)N(C)CCC(CCC)P(=O)(O)O |
| InChI | InChI=1S/C10H20NO4P/c1-4-6-9(16(13,14)15)7-8-11(3)10(12)5-2/h5,9H,2,4,6-8H2,1,3H3,(H2,13,14,15) |
| InChIKey | HKWQDWAMQLSHDC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|