C22H32O5 — CID 90827188
(4S,17R)-4-hydroperoxy-17-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid (PubChem CID 90827188) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (4S,17R)-4-hydroperoxy-17-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid.
| Compound Name | (4S,17R)-4-hydroperoxy-17-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
|---|---|
| PubChem CID | 90827188 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (4S,17R)-4-hydroperoxy-17-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
| SMILES | CCC=CC[C@@H](O)C=CC=CCC=CCC=CC=C[C@H](CCC(=O)O)OO |
| InChI | InChI=1S/C22H32O5/c1-2-3-12-15-20(23)16-13-10-8-6-4-5-7-9-11-14-17-21(27-26)18-19-22(24)25/h3-5,8-14,16-17,20-21,23,26H,2,6-7,15,18-19H2,1H3,(H,24,25)/t20-,21-/m1/s1 |
| InChIKey | ZKUDWLWHTKEJGJ-NHCUHLMSSA-N |
| XLogP | 4.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|