C44H82N2O16 — CID 90831416
(2,5-dihydroxypyrrol-1-yl) 6-[1,3-bis[2-[2-[2-(2-heptoxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yloxycarbonylamino]hexanoate (PubChem CID 90831416) has the molecular formula C44H82N2O16 and a molecular weight of 895.14 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[1,3-bis[2-[2-[2-(2-heptoxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yloxycarbonylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[1,3-bis[2-[2-[2-(2-heptoxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yloxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 90831416 |
| Molecular Formula | C44H82N2O16 |
| Molecular Weight | 895.14 g/mol |
| Exact Mass | 894.57 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[1,3-bis[2-[2-[2-(2-heptoxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yloxycarbonylamino]hexanoate |
| SMILES | CCCCCCCOCCOCCOCCOCCOCC(COCCOCCOCCOCCOCCCCCCC)OC(=O)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C44H82N2O16/c1-3-5-7-9-14-20-51-22-24-53-26-28-55-30-32-57-34-36-59-38-40(61-44(50)45-19-13-11-12-16-43(49)62-46-41(47)17-18-42(46)48)39-60-37-35-58-33-31-56-29-27-54-25-23-52-21-15-10-8-6-4-2/h17-18,40,47-48H,3-16,19-39H2,1-2H3,(H,45,50) |
| InChIKey | MTOJBVBRGOBVAB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 202.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.14 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|