C21H27N5O3 — CID 90832925
tert-butyl N-[1-[2-(6-cyano-3-oxo-4H-quinoxalin-2-yl)ethyl]piperidin-4-yl]carbamate (PubChem CID 90832925) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(6-cyano-3-oxo-4H-quinoxalin-2-yl)ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(6-cyano-3-oxo-4H-quinoxalin-2-yl)ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90832925 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl N-[1-[2-(6-cyano-3-oxo-4H-quinoxalin-2-yl)ethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CCc2nc3ccc(C#N)cc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-21(2,3)29-20(28)23-15-6-9-26(10-7-15)11-8-17-19(27)25-18-12-14(13-22)4-5-16(18)24-17/h4-5,12,15H,6-11H2,1-3H3,(H,23,28)(H,25,27) |
| InChIKey | MHCJEQKTWRSPHH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |