C24H20N2S — CID 90832971
N-hexa-1,3,5-trien-2-yl-N-methyl-1-phenyl-[1]benzothiolo[2,3-c]pyridin-3-amine (PubChem CID 90832971) has the molecular formula C24H20N2S and a molecular weight of 368.51 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-2-yl-N-methyl-1-phenyl-[1]benzothiolo[2,3-c]pyridin-3-amine.
| Compound Name | N-hexa-1,3,5-trien-2-yl-N-methyl-1-phenyl-[1]benzothiolo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 90832971 |
| Molecular Formula | C24H20N2S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-hexa-1,3,5-trien-2-yl-N-methyl-1-phenyl-[1]benzothiolo[2,3-c]pyridin-3-amine |
| SMILES | C=CC=CC(=C)N(C)c1cc2c(sc3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H20N2S/c1-4-5-11-17(2)26(3)22-16-20-19-14-9-10-15-21(19)27-24(20)23(25-22)18-12-7-6-8-13-18/h4-16H,1-2H2,3H3 |
| InChIKey | IAGXNIUQVCFNTH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|