C19H18N2O3S — CID 90837717
2-(3-methoxyphenyl)-6-methyl-2'-sulfanylidenespiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one (PubChem CID 90837717) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-6-methyl-2'-sulfanylidenespiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one.
| Compound Name | 2-(3-methoxyphenyl)-6-methyl-2'-sulfanylidenespiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 90837717 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-(3-methoxyphenyl)-6-methyl-2'-sulfanylidenespiro[2,3-dihydrochromene-4,5'-imidazolidine]-4'-one |
| SMILES | COc1cccc(C2CC3(NC(=S)NC3=O)c3cc(C)ccc3O2)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-11-6-7-15-14(8-11)19(17(22)20-18(25)21-19)10-16(24-15)12-4-3-5-13(9-12)23-2/h3-9,16H,10H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | LLGRYYXVNHJCMZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|