C23H22N2O5S — CID 10526991
7,11-bis(3-methoxyphenyl)-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5,9-trione (PubChem CID 10526991) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is 7,11-bis(3-methoxyphenyl)-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5,9-trione.
| Compound Name | 7,11-bis(3-methoxyphenyl)-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 10526991 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 7,11-bis(3-methoxyphenyl)-3-sulfanylidene-2,4-diazaspiro[5.5]undecane-1,5,9-trione |
| SMILES | COc1cccc(C2CC(=O)CC(c3cccc(OC)c3)C23C(=O)NC(=S)NC3=O)c1 |
| InChI | InChI=1S/C23H22N2O5S/c1-29-16-7-3-5-13(9-16)18-11-15(26)12-19(14-6-4-8-17(10-14)30-2)23(18)20(27)24-22(31)25-21(23)28/h3-10,18-19H,11-12H2,1-2H3,(H2,24,25,27,28,31) |
| InChIKey | SVIKSWBOWXRNNG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|