C23H22N2O6 — CID 11742959
11-(2,4-dimethoxyphenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 11742959) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 11-(2,4-dimethoxyphenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | 11-(2,4-dimethoxyphenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 11742959 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 11-(2,4-dimethoxyphenyl)-7-phenyl-2,4-diazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | COc1ccc(C2CC(=O)CC(c3ccccc3)C23C(=O)NC(=O)NC3=O)c(OC)c1 |
| InChI | InChI=1S/C23H22N2O6/c1-30-15-8-9-16(19(12-15)31-2)18-11-14(26)10-17(13-6-4-3-5-7-13)23(18)20(27)24-22(29)25-21(23)28/h3-9,12,17-18H,10-11H2,1-2H3,(H2,24,25,27,28,29) |
| InChIKey | WDIZDHXKICYQFX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|