C19H16N2O5 — CID 125430159
(2'R)-2'-(3-methoxyphenyl)spiro[1,3-diazinane-5,3'-2,4-dihydrochromene]-2,4,6-trione (PubChem CID 125430159) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is (2'R)-2'-(3-methoxyphenyl)spiro[1,3-diazinane-5,3'-2,4-dihydrochromene]-2,4,6-trione.
| Compound Name | (2'R)-2'-(3-methoxyphenyl)spiro[1,3-diazinane-5,3'-2,4-dihydrochromene]-2,4,6-trione |
|---|---|
| PubChem CID | 125430159 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2'R)-2'-(3-methoxyphenyl)spiro[1,3-diazinane-5,3'-2,4-dihydrochromene]-2,4,6-trione |
| SMILES | COc1cccc([C@H]2Oc3ccccc3CC23C(=O)NC(=O)NC3=O)c1 |
| InChI | InChI=1S/C19H16N2O5/c1-25-13-7-4-6-11(9-13)15-19(16(22)20-18(24)21-17(19)23)10-12-5-2-3-8-14(12)26-15/h2-9,15H,10H2,1H3,(H2,20,21,22,23,24)/t15-/m1/s1 |
| InChIKey | BHUQWUKGWSIOPA-OAHLLOKOSA-N |
| XLogP | 1.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|