C23H24N2O3 — CID 172765225
6'-but-1-en-2-yl-4'-(3-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 172765225) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 6'-but-1-en-2-yl-4'-(3-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 6'-but-1-en-2-yl-4'-(3-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 172765225 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 6'-but-1-en-2-yl-4'-(3-methoxyphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C=C(CC)C1NC(=O)CC(c2cccc(OC)c2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C23H24N2O3/c1-4-14(2)21-23(17-10-5-6-11-19(17)24-22(23)27)18(13-20(26)25-21)15-8-7-9-16(12-15)28-3/h5-12,18,21H,2,4,13H2,1,3H3,(H,24,27)(H,25,26) |
| InChIKey | MFJVHLSEOZYCDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|