C17H15ClN2O6S — CID 9084177
methyl (2R)-4-[5-(2-chloro-4-nitrophenyl)furan-2-carbonyl]thiomorpholine-2-carboxylate (PubChem CID 9084177) has the molecular formula C17H15ClN2O6S and a molecular weight of 410.84 g/mol. Its IUPAC name is methyl (2R)-4-[5-(2-chloro-4-nitrophenyl)furan-2-carbonyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-[5-(2-chloro-4-nitrophenyl)furan-2-carbonyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9084177 |
| Molecular Formula | C17H15ClN2O6S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | methyl (2R)-4-[5-(2-chloro-4-nitrophenyl)furan-2-carbonyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)CCS1 |
| InChI | InChI=1S/C17H15ClN2O6S/c1-25-17(22)15-9-19(6-7-27-15)16(21)14-5-4-13(26-14)11-3-2-10(20(23)24)8-12(11)18/h2-5,8,15H,6-7,9H2,1H3/t15-/m1/s1 |
| InChIKey | SKRYRSVSUVUAER-OAHLLOKOSA-N |
| XLogP | 3.24 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|