C19H22NO4+ — CID 90842108
2-[(4-methoxyphenyl)methyl]-4-oxo-7-phenyl-1,4-oxazepan-4-ium-6-ol (PubChem CID 90842108) has the molecular formula C19H22NO4+ and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-4-oxo-7-phenyl-1,4-oxazepan-4-ium-6-ol.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-4-oxo-7-phenyl-1,4-oxazepan-4-ium-6-ol |
|---|---|
| PubChem CID | 90842108 |
| Molecular Formula | C19H22NO4+ |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-4-oxo-7-phenyl-1,4-oxazepan-4-ium-6-ol |
| SMILES | COc1ccc(CC2C[N+](=O)CC(O)C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C19H22NO4/c1-23-16-9-7-14(8-10-16)11-17-12-20(22)13-18(21)19(24-17)15-5-3-2-4-6-15/h2-10,17-19,21H,11-13H2,1H3/q+1 |
| InChIKey | XYOAEZDYVZNBSX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|