C24H32N6O2 — CID 90842906
2-[5-hydroxy-4-methyl-2-[[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]amino]anilino]acetaldehyde (PubChem CID 90842906) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[5-hydroxy-4-methyl-2-[[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]amino]anilino]acetaldehyde.
| Compound Name | 2-[5-hydroxy-4-methyl-2-[[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]amino]anilino]acetaldehyde |
|---|---|
| PubChem CID | 90842906 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-[5-hydroxy-4-methyl-2-[[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]amino]anilino]acetaldehyde |
| SMILES | Cc1cc(Nc2c(NCCCN3CCCCC3)nn3ccccc23)c(NCC=O)cc1O |
| InChI | InChI=1S/C24H32N6O2/c1-18-16-20(19(17-22(18)32)25-10-15-31)27-23-21-8-3-6-14-30(21)28-24(23)26-9-7-13-29-11-4-2-5-12-29/h3,6,8,14-17,25,27,32H,2,4-5,7,9-13H2,1H3,(H,26,28) |
| InChIKey | DSSYKFWYKJYTNO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|