C23H28N6O2 — CID 59561363
7-[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-3,4-dihydro-2H-1,4-benzoxazin-6-one (PubChem CID 59561363) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 7-[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-3,4-dihydro-2H-1,4-benzoxazin-6-one.
| Compound Name | 7-[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-3,4-dihydro-2H-1,4-benzoxazin-6-one |
|---|---|
| PubChem CID | 59561363 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 7-[2-(3-piperidin-1-ylpropylamino)pyrazolo[1,5-a]pyridin-3-yl]imino-3,4-dihydro-2H-1,4-benzoxazin-6-one |
| SMILES | O=C1C=C2NCCOC2=C/C1=N\c1c(NCCCN2CCCCC2)nn2ccccc12 |
| InChI | InChI=1S/C23H28N6O2/c30-20-15-18-21(31-14-9-24-18)16-17(20)26-22-19-7-2-5-13-29(19)27-23(22)25-8-6-12-28-10-3-1-4-11-28/h2,5,7,13,15-16,24H,1,3-4,6,8-12,14H2,(H,25,27)/b26-17+ |
| InChIKey | PTPIRHUDDCWKFL-YZSQISJMSA-N |
| XLogP | 2.66 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|