C23H15FN4OS2 — CID 90843126
5-[[5-(4-fluorophenyl)-2-phenyl-2H-pyrrol-4-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 90843126) has the molecular formula C23H15FN4OS2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 5-[[5-(4-fluorophenyl)-2-phenyl-2H-pyrrol-4-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(4-fluorophenyl)-2-phenyl-2H-pyrrol-4-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 90843126 |
| Molecular Formula | C23H15FN4OS2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 5-[[5-(4-fluorophenyl)-2-phenyl-2H-pyrrol-4-yl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=CC2=CC(c3ccccc3)N=C2c2ccc(F)cc2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C23H15FN4OS2/c24-17-8-6-15(7-9-17)20-16(12-18(27-20)14-4-2-1-3-5-14)13-19-21(29)28(22(25)31-19)23-26-10-11-30-23/h1-13,18,25H/b19-13?,25-22- |
| InChIKey | VVXURKATLDTDIT-ILWGIXHPSA-N |
| XLogP | 5.35 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|