C26H33N3O5S2 — CID 90844705
methyl 4-[4-[2-adamantyl(methylsulfonyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoate (PubChem CID 90844705) has the molecular formula C26H33N3O5S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is methyl 4-[4-[2-adamantyl(methylsulfonyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoate.
| Compound Name | methyl 4-[4-[2-adamantyl(methylsulfonyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 90844705 |
| Molecular Formula | C26H33N3O5S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | methyl 4-[4-[2-adamantyl(methylsulfonyl)carbamoyl]-5-propylsulfanylpyrazol-1-yl]benzoate |
| SMILES | CCCSc1c(C(=O)N(C2C3CC4CC(C3)CC2C4)S(C)(=O)=O)cnn1-c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H33N3O5S2/c1-4-9-35-25-22(15-27-28(25)21-7-5-18(6-8-21)26(31)34-2)24(30)29(36(3,32)33)23-19-11-16-10-17(13-19)14-20(23)12-16/h5-8,15-17,19-20,23H,4,9-14H2,1-3H3 |
| InChIKey | UDQCPYWWAXHKAI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |