C22H26NO4S2+ — CID 90844725
benzyl 2-methyl-3-[[2-(methylamino)-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate (PubChem CID 90844725) has the molecular formula C22H26NO4S2+ and a molecular weight of 432.59 g/mol. Its IUPAC name is benzyl 2-methyl-3-[[2-(methylamino)-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate.
| Compound Name | benzyl 2-methyl-3-[[2-(methylamino)-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 90844725 |
| Molecular Formula | C22H26NO4S2+ |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | benzyl 2-methyl-3-[[2-(methylamino)-3-oxo-3-phenylmethoxypropyl]disulfanyl]propanoate |
| SMILES | [CH2+]C(CSSCC(NC)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26NO4S2/c1-17(21(24)26-13-18-9-5-3-6-10-18)15-28-29-16-20(23-2)22(25)27-14-19-11-7-4-8-12-19/h3-12,17,20,23H,1,13-16H2,2H3/q+1 |
| InChIKey | KJXIZVNYJNGYNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|