C12H15NO9 — CID 90846201
2-[(3S)-3-carboxy-3-(2,5-dihydroxypyrrol-1-yl)propoxy]butanedioic acid (PubChem CID 90846201) has the molecular formula C12H15NO9 and a molecular weight of 317.25 g/mol. Its IUPAC name is 2-[(3S)-3-carboxy-3-(2,5-dihydroxypyrrol-1-yl)propoxy]butanedioic acid.
| Compound Name | 2-[(3S)-3-carboxy-3-(2,5-dihydroxypyrrol-1-yl)propoxy]butanedioic acid |
|---|---|
| PubChem CID | 90846201 |
| Molecular Formula | C12H15NO9 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[(3S)-3-carboxy-3-(2,5-dihydroxypyrrol-1-yl)propoxy]butanedioic acid |
| SMILES | O=C(O)CC(OCC[C@@H](C(=O)O)n1c(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C12H15NO9/c14-8-1-2-9(15)13(8)6(11(18)19)3-4-22-7(12(20)21)5-10(16)17/h1-2,6-7,14-15H,3-5H2,(H,16,17)(H,18,19)(H,20,21)/t6-,7?/m0/s1 |
| InChIKey | PWPOINSFGMTIIM-PKPIPKONSA-N |
| XLogP | -0.14 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |