C14H21NO6 — CID 90929767
dipropyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate (PubChem CID 90929767) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is dipropyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate.
| Compound Name | dipropyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate |
|---|---|
| PubChem CID | 90929767 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | dipropyl 2-(2,5-dihydroxypyrrol-1-yl)butanedioate |
| SMILES | CCCOC(=O)CC(C(=O)OCCC)n1c(O)ccc1O |
| InChI | InChI=1S/C14H21NO6/c1-3-7-20-13(18)9-10(14(19)21-8-4-2)15-11(16)5-6-12(15)17/h5-6,10,16-17H,3-4,7-9H2,1-2H3 |
| InChIKey | UOQIEYNGHNAWSJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |