C19H15N3O — CID 90846305
3-(4-phenyl-1,4-dihydropyrimidin-6-yl)-1H-quinolin-2-one (PubChem CID 90846305) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(4-phenyl-1,4-dihydropyrimidin-6-yl)-1H-quinolin-2-one.
| Compound Name | 3-(4-phenyl-1,4-dihydropyrimidin-6-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90846305 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(4-phenyl-1,4-dihydropyrimidin-6-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1C1=CC(c2ccccc2)N=CN1 |
| InChI | InChI=1S/C19H15N3O/c23-19-15(10-14-8-4-5-9-16(14)22-19)18-11-17(20-12-21-18)13-6-2-1-3-7-13/h1-12,17H,(H,20,21)(H,22,23) |
| InChIKey | JEGNDXVRZHZYPX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |