C31H34N4O6 — CID 90847051
tert-butyl N-[2-[4-[2-[6-[3-methoxy-4-(methoxymethoxy)phenyl]-1H-indazol-3-yl]ethenyl]anilino]-2-oxoethyl]carbamate (PubChem CID 90847051) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-[6-[3-methoxy-4-(methoxymethoxy)phenyl]-1H-indazol-3-yl]ethenyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-[6-[3-methoxy-4-(methoxymethoxy)phenyl]-1H-indazol-3-yl]ethenyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 90847051 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | tert-butyl N-[2-[4-[2-[6-[3-methoxy-4-(methoxymethoxy)phenyl]-1H-indazol-3-yl]ethenyl]anilino]-2-oxoethyl]carbamate |
| SMILES | COCOc1ccc(-c2ccc3c(C=Cc4ccc(NC(=O)CNC(=O)OC(C)(C)C)cc4)n[nH]c3c2)cc1OC |
| InChI | InChI=1S/C31H34N4O6/c1-31(2,3)41-30(37)32-18-29(36)33-23-11-6-20(7-12-23)8-14-25-24-13-9-21(16-26(24)35-34-25)22-10-15-27(40-19-38-4)28(17-22)39-5/h6-17H,18-19H2,1-5H3,(H,32,37)(H,33,36)(H,34,35) |
| InChIKey | UANKYVFSGLMRNU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|