C29H35FN4O8 — CID 90853295
9-[[2-(cyclopentylamino)acetyl]amino]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-5a-methyl-1,3,11,12-tetraoxo-4a,5,6,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 90853295) has the molecular formula C29H35FN4O8 and a molecular weight of 586.62 g/mol. Its IUPAC name is 9-[[2-(cyclopentylamino)acetyl]amino]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-5a-methyl-1,3,11,12-tetraoxo-4a,5,6,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-[[2-(cyclopentylamino)acetyl]amino]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-5a-methyl-1,3,11,12-tetraoxo-4a,5,6,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90853295 |
| Molecular Formula | C29H35FN4O8 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 9-[[2-(cyclopentylamino)acetyl]amino]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-5a-methyl-1,3,11,12-tetraoxo-4a,5,6,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)c(NC(=O)CNC5CCCC5)cc(F)c4CC3(C)CC12 |
| InChI | InChI=1S/C29H35FN4O8/c1-28-9-13-15(30)8-16(33-17(35)11-32-12-6-4-5-7-12)22(36)18(13)23(37)20(28)26(40)29(42)14(10-28)21(34(2)3)24(38)19(25(29)39)27(31)41/h8,12,14,19-21,32,36,42H,4-7,9-11H2,1-3H3,(H2,31,41)(H,33,35) |
| InChIKey | NQGAKIUBKYJSAO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|