C22H37NO6S — CID 90857062
butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate (PubChem CID 90857062) has the molecular formula C22H37NO6S and a molecular weight of 443.61 g/mol. Its IUPAC name is butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate.
| Compound Name | butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate |
|---|---|
| PubChem CID | 90857062 |
| Molecular Formula | C22H37NO6S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate |
| SMILES | CCCCOC(=O)COCCN(CC(C)C)S(=O)(=O)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C22H37NO6S/c1-8-9-11-29-21(24)15-28-12-10-23(14-16(2)3)30(25,26)22-17(4)13-20(27-7)18(5)19(22)6/h13,16H,8-12,14-15H2,1-7H3 |
| InChIKey | BASWVLQZCODECN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|