About butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate
butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate (PubChem CID 90857062) has the molecular formula C22H37NO6S
and a molecular weight of 443.61 g/mol. Its IUPAC name is butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate.
Molecular Properties
| Compound Name | butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate |
| PubChem CID | 90857062 |
| Molecular Formula | C22H37NO6S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate |
| SMILES | CCCCOC(=O)COCCN(CC(C)C)S(=O)(=O)c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C22H37NO6S/c1-8-9-11-29-21(24)15-28-12-10-23(14-16(2)3)30(25,26)22-17(4)13-20(27-7)18(5)19(22)6/h13,16H,8-12,14-15H2,1-7H3 |
| InChIKey | BASWVLQZCODECN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate?
The IUPAC name of butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate (CID 90857062) is butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate.
What is the SMILES notation for butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate?
The canonical SMILES for butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate is CCCCOC(=O)COCCN(CC(C)C)S(=O)(=O)c1c(C)cc(OC)c(C)c1C.
What is the InChIKey of butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate?
The InChIKey is BASWVLQZCODECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37NO6S/c1-8-9-11-29-21(24)15-28-12-10-23(14-16(2)3)30(25,26)22-17(4)13-20(27-7)18(5)19(22)6/h13,16H,8-12,14-15H2,1-7H3.
What are the key properties of butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate?
butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate has a molecular weight of 443.61 g/mol, XLogP of 3.63, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonyl-(2-methylpropyl)amino]ethoxy]acetate is sourced from PubChem (CID 90857062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).