C30H48N4O5S — CID 88879276
N-[2-[2-[6-[(dimethylamino)methyl]-1-ethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-2,3,6-trimethyl-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 88879276) has the molecular formula C30H48N4O5S and a molecular weight of 576.80 g/mol. Its IUPAC name is N-[2-[2-[6-[(dimethylamino)methyl]-1-ethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-2,3,6-trimethyl-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[2-[2-[6-[(dimethylamino)methyl]-1-ethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-2,3,6-trimethyl-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88879276 |
| Molecular Formula | C30H48N4O5S |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | N-[2-[2-[6-[(dimethylamino)methyl]-1-ethyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-3-yl]-2-oxoethoxy]ethyl]-4-methoxy-2,3,6-trimethyl-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CCC1NC(C(=O)COCCN(CC(C)C)S(=O)(=O)c2c(C)cc(OC)c(C)c2C)Cn2c(CN(C)C)ccc21 |
| InChI | InChI=1S/C30H48N4O5S/c1-10-25-27-12-11-24(17-32(7)8)34(27)18-26(31-25)28(35)19-39-14-13-33(16-20(2)3)40(36,37)30-21(4)15-29(38-9)22(5)23(30)6/h11-12,15,20,25-26,31H,10,13-14,16-19H2,1-9H3 |
| InChIKey | CENFZLNDYDBGHP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|