C22H34O4S6 — CID 90857090
1-[3-[1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]-2-hydroxypropoxy]phenoxy]-5-(1,3-dithiolan-2-ylsulfanyl)pentan-2-ol (PubChem CID 90857090) has the molecular formula C22H34O4S6 and a molecular weight of 554.91 g/mol. Its IUPAC name is 1-[3-[1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]-2-hydroxypropoxy]phenoxy]-5-(1,3-dithiolan-2-ylsulfanyl)pentan-2-ol.
| Compound Name | 1-[3-[1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]-2-hydroxypropoxy]phenoxy]-5-(1,3-dithiolan-2-ylsulfanyl)pentan-2-ol |
|---|---|
| PubChem CID | 90857090 |
| Molecular Formula | C22H34O4S6 |
| Molecular Weight | 554.91 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 1-[3-[1-[2-(1,3-dithiolan-2-yl)ethylsulfanyl]-2-hydroxypropoxy]phenoxy]-5-(1,3-dithiolan-2-ylsulfanyl)pentan-2-ol |
| SMILES | CC(O)C(Oc1cccc(OCC(O)CCCSC2SCCS2)c1)SCCC1SCCS1 |
| InChI | InChI=1S/C22H34O4S6/c1-16(23)21(29-9-7-20-27-10-11-28-20)26-19-6-2-5-18(14-19)25-15-17(24)4-3-8-30-22-31-12-13-32-22/h2,5-6,14,16-17,20-24H,3-4,7-13,15H2,1H3 |
| InChIKey | KODIKXGEEIVWIQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|