C12H19NO5 — CID 90859132
1-[2-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethoxy]ethoxy]propan-2-one (PubChem CID 90859132) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[2-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethoxy]ethoxy]propan-2-one.
| Compound Name | 1-[2-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethoxy]ethoxy]propan-2-one |
|---|---|
| PubChem CID | 90859132 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[2-[2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethoxy]ethoxy]propan-2-one |
| SMILES | CC(=O)COCCOCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C12H19NO5/c1-9-7-11(15)13(12(9)16)3-4-17-5-6-18-8-10(2)14/h7,15-16H,3-6,8H2,1-2H3 |
| InChIKey | LHGGBCYSLPGMGL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|