C20H22O — CID 90859699
3-[3-[2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propanal (PubChem CID 90859699) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is 3-[3-[2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propanal.
| Compound Name | 3-[3-[2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propanal |
|---|---|
| PubChem CID | 90859699 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-[3-[2-(2,6-dimethylphenyl)ethenyl]-2-methylphenyl]propanal |
| SMILES | Cc1cccc(C)c1C=Cc1cccc(CCC=O)c1C |
| InChI | InChI=1S/C20H22O/c1-15-7-4-8-16(2)20(15)13-12-19-10-5-9-18(17(19)3)11-6-14-21/h4-5,7-10,12-14H,6,11H2,1-3H3 |
| InChIKey | RYYGUVIGNKOCPF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|