C18H30N6O4 — CID 90860758
ethane;ethyl 2-aminopyrimidine-5-carboxylate;ethyl 4-aminopyrimidine-2-carboxylate (PubChem CID 90860758) has the molecular formula C18H30N6O4 and a molecular weight of 394.48 g/mol. Its IUPAC name is ethane;ethyl 2-aminopyrimidine-5-carboxylate;ethyl 4-aminopyrimidine-2-carboxylate.
| Compound Name | ethane;ethyl 2-aminopyrimidine-5-carboxylate;ethyl 4-aminopyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 90860758 |
| Molecular Formula | C18H30N6O4 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | ethane;ethyl 2-aminopyrimidine-5-carboxylate;ethyl 4-aminopyrimidine-2-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1cnc(N)nc1.CCOC(=O)c1nccc(N)n1 |
| InChI | InChI=1S/2C7H9N3O2.2C2H6/c1-2-12-6(11)5-3-9-7(8)10-4-5;1-2-12-7(11)6-9-4-3-5(8)10-6;2*1-2/h2*3-4H,2H2,1H3,(H2,8,9,10);2*1-2H3 |
| InChIKey | KOSRNRQEEWAZAY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |