C11H13N3O — CID 90868261
5-methoxy-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-imine (PubChem CID 90868261) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-methoxy-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 5-methoxy-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90868261 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-methoxy-4-(4-methylimidazol-1-yl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(n2cnc(C)c2)=C(OC)C1 |
| InChI | InChI=1S/C11H13N3O/c1-8-6-14(7-13-8)10-4-3-9(12)5-11(10)15-2/h3-4,6-7,12H,5H2,1-2H3/b12-9+ |
| InChIKey | KXOKUZYXHLNLKY-FMIVXFBMSA-N |
| XLogP | 1.99 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|