C29H34N2O5S — CID 90869184
2-[4-hydroxy-5-[2-methyl-4-(3-octylbenzo[g][1,3]benzoxazol-2-ylidene)but-1-enyl]-2-oxo-1,3-thiazol-3-yl]acetic acid (PubChem CID 90869184) has the molecular formula C29H34N2O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is 2-[4-hydroxy-5-[2-methyl-4-(3-octylbenzo[g][1,3]benzoxazol-2-ylidene)but-1-enyl]-2-oxo-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-5-[2-methyl-4-(3-octylbenzo[g][1,3]benzoxazol-2-ylidene)but-1-enyl]-2-oxo-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 90869184 |
| Molecular Formula | C29H34N2O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 2-[4-hydroxy-5-[2-methyl-4-(3-octylbenzo[g][1,3]benzoxazol-2-ylidene)but-1-enyl]-2-oxo-1,3-thiazol-3-yl]acetic acid |
| SMILES | CCCCCCCCN1C(=CCC(C)=Cc2sc(=O)n(CC(=O)O)c2O)Oc2c1ccc1ccccc21 |
| InChI | InChI=1S/C29H34N2O5S/c1-3-4-5-6-7-10-17-30-23-15-14-21-11-8-9-12-22(21)27(23)36-25(30)16-13-20(2)18-24-28(34)31(19-26(32)33)29(35)37-24/h8-9,11-12,14-16,18,34H,3-7,10,13,17,19H2,1-2H3,(H,32,33) |
| InChIKey | MWIMFUXYWFMYOA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|