C20H16F2N2 — CID 90871376
(6,7-difluoro-6'-methylspiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide (PubChem CID 90871376) has the molecular formula C20H16F2N2 and a molecular weight of 322.36 g/mol. Its IUPAC name is (6,7-difluoro-6'-methylspiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide.
| Compound Name | (6,7-difluoro-6'-methylspiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide |
|---|---|
| PubChem CID | 90871376 |
| Molecular Formula | C20H16F2N2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (6,7-difluoro-6'-methylspiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide |
| SMILES | Cc1ccc2c(c1)/C(=N\C#N)C1(CCc3cc(F)c(F)cc3C1)C2 |
| InChI | InChI=1S/C20H16F2N2/c1-12-2-3-14-9-20(19(24-11-23)16(14)6-12)5-4-13-7-17(21)18(22)8-15(13)10-20/h2-3,6-8H,4-5,9-10H2,1H3/b24-19+ |
| InChIKey | GMVSUKDIIHBTNB-LYBHJNIJSA-N |
| XLogP | 4.27 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|