C9H14N2O — CID 90872573
7-methylidene-1,3,4,4a,5,6,8,8a-octahydroquinoxalin-2-one (PubChem CID 90872573) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 7-methylidene-1,3,4,4a,5,6,8,8a-octahydroquinoxalin-2-one.
| Compound Name | 7-methylidene-1,3,4,4a,5,6,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 90872573 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 7-methylidene-1,3,4,4a,5,6,8,8a-octahydroquinoxalin-2-one |
| SMILES | C=C1CCC2NCC(=O)NC2C1 |
| InChI | InChI=1S/C9H14N2O/c1-6-2-3-7-8(4-6)11-9(12)5-10-7/h7-8,10H,1-5H2,(H,11,12) |
| InChIKey | CSMZEVRSZSWKBB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|