C10H16N2O — CID 90956905
4-methyl-7-methylidene-3,4a,5,6,8,8a-hexahydro-1H-quinoxalin-2-one (PubChem CID 90956905) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-7-methylidene-3,4a,5,6,8,8a-hexahydro-1H-quinoxalin-2-one.
| Compound Name | 4-methyl-7-methylidene-3,4a,5,6,8,8a-hexahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 90956905 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-methyl-7-methylidene-3,4a,5,6,8,8a-hexahydro-1H-quinoxalin-2-one |
| SMILES | C=C1CCC2C(C1)NC(=O)CN2C |
| InChI | InChI=1S/C10H16N2O/c1-7-3-4-9-8(5-7)11-10(13)6-12(9)2/h8-9H,1,3-6H2,2H3,(H,11,13) |
| InChIKey | XFRPHEPKFKXFJC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|