C31H24O11 — CID 90872831
methyl 3,6-dihydroxy-2-[(1S)-7,9,14,16-tetrahydroxy-5-methyl-2,11-dioxopentacyclo[10.7.2.01,10.03,8.013,18]henicosa-3(8),4,6,12(21),13,15,17-heptaene-15-carbonyl]benzoate (PubChem CID 90872831) has the molecular formula C31H24O11 and a molecular weight of 572.52 g/mol. Its IUPAC name is methyl 3,6-dihydroxy-2-[(1S)-7,9,14,16-tetrahydroxy-5-methyl-2,11-dioxopentacyclo[10.7.2.01,10.03,8.013,18]henicosa-3(8),4,6,12(21),13,15,17-heptaene-15-carbonyl]benzoate.
| Compound Name | methyl 3,6-dihydroxy-2-[(1S)-7,9,14,16-tetrahydroxy-5-methyl-2,11-dioxopentacyclo[10.7.2.01,10.03,8.013,18]henicosa-3(8),4,6,12(21),13,15,17-heptaene-15-carbonyl]benzoate |
|---|---|
| PubChem CID | 90872831 |
| Molecular Formula | C31H24O11 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | methyl 3,6-dihydroxy-2-[(1S)-7,9,14,16-tetrahydroxy-5-methyl-2,11-dioxopentacyclo[10.7.2.01,10.03,8.013,18]henicosa-3(8),4,6,12(21),13,15,17-heptaene-15-carbonyl]benzoate |
| SMILES | COC(=O)c1c(O)ccc(O)c1C(=O)c1c(O)cc2c(c1O)C1=CC[C@@]3(C2)C(=O)c2cc(C)cc(O)c2C(O)C3C1=O |
| InChI | InChI=1S/C31H24O11/c1-11-7-14-20(17(34)8-11)28(39)24-25(36)13-5-6-31(24,29(14)40)10-12-9-18(35)23(26(37)19(12)13)27(38)21-15(32)3-4-16(33)22(21)30(41)42-2/h3-5,7-9,24,28,32-35,37,39H,6,10H2,1-2H3/t24?,28?,31-/m0/s1 |
| InChIKey | CGFNKXKPNCHWDB-RBZQUPMNSA-N |
| XLogP | 2.99 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|