C16H26O6 — CID 90874854
dimethyl 2-(2,2-dimethylpropanoyl)-4,4-dimethyl-5-oxoheptanedioate (PubChem CID 90874854) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is dimethyl 2-(2,2-dimethylpropanoyl)-4,4-dimethyl-5-oxoheptanedioate.
| Compound Name | dimethyl 2-(2,2-dimethylpropanoyl)-4,4-dimethyl-5-oxoheptanedioate |
|---|---|
| PubChem CID | 90874854 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | dimethyl 2-(2,2-dimethylpropanoyl)-4,4-dimethyl-5-oxoheptanedioate |
| SMILES | COC(=O)CC(=O)C(C)(C)CC(C(=O)OC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H26O6/c1-15(2,3)13(19)10(14(20)22-7)9-16(4,5)11(17)8-12(18)21-6/h10H,8-9H2,1-7H3 |
| InChIKey | AXSOTYHFCPOGCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|