C57H77BN5O3+2 — CID 90878062
CID 90878062 (PubChem CID 90878062) has the molecular formula C57H77BN5O3+2 and a molecular weight of 891.09 g/mol.
| Compound Name | CID 90878062 |
|---|---|
| PubChem CID | 90878062 |
| Molecular Formula | C57H77BN5O3+2 |
| Molecular Weight | 891.09 g/mol |
| Exact Mass | 890.61 |
| IUPAC Name | — |
| SMILES | CC1(C)C(=CC=CC=C2CCC(=CC=CC=C3N(CCC[N+](C)(C)C)c4ccc(C(N)=O)cc4C3(C)C)C2=O)N(CCC[N+](C)(C)C)c2ccc(C=O)cc21.CCCC[B]c1ccccc1 |
| InChI | InChI=1S/C47H62N5O3.C10H14B/c1-46(2)38-31-34(33-53)21-25-40(38)49(27-15-29-51(5,6)7)42(46)19-13-11-17-35-22-23-36(44(35)54)18-12-14-20-43-47(3,4)39-32-37(45(48)55)24-26-41(39)50(43)28-16-30-52(8,9)10;1-2-3-9-11-10-7-5-4-6-8-10/h11-14,17-21,24-26,31-33H,15-16,22-23,27-30H2,1-10H3,(H-,48,55);4-8H,2-3,9H2,1H3/q+1;/p+1 |
| InChIKey | ZCWDQFKBHMHFBI-UHFFFAOYSA-O |
| XLogP | 10.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.09 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|