C11H8INO4 — CID 90888627
(2,5-dihydroxypyrrol-1-yl) 3-(125I)iodobenzoate (PubChem CID 90888627) has the molecular formula C11H8INO4 and a molecular weight of 343.09 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(125I)iodobenzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(125I)iodobenzoate |
|---|---|
| PubChem CID | 90888627 |
| Molecular Formula | C11H8INO4 |
| Molecular Weight | 343.09 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(125I)iodobenzoate |
| SMILES | O=C(On1c(O)ccc1O)c1cccc([125I])c1 |
| InChI | InChI=1S/C11H8INO4/c12-8-3-1-2-7(6-8)11(16)17-13-9(14)4-5-10(13)15/h1-6,14-15H/i12-2 |
| InChIKey | FUMQZEKMCUCNMN-DACUFJSSSA-N |
| XLogP | 1.77 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|