C12H24OSi — CID 90889235
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yloxy(trimethyl)silane (PubChem CID 90889235) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yloxy(trimethyl)silane.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 90889235 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yloxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OC1CC2CCCCC2C1 |
| InChI | InChI=1S/C12H24OSi/c1-14(2,3)13-12-8-10-6-4-5-7-11(10)9-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | IZKXLMDPTIWEAB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|