C13H15N3O4 — CID 90890648
bis(propylideneamino) pyridine-2,3-dicarboxylate (PubChem CID 90890648) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is bis(propylideneamino) pyridine-2,3-dicarboxylate.
| Compound Name | bis(propylideneamino) pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 90890648 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | bis(propylideneamino) pyridine-2,3-dicarboxylate |
| SMILES | CCC=NOC(=O)c1cccnc1C(=O)ON=CCC |
| InChI | InChI=1S/C13H15N3O4/c1-3-7-15-19-12(17)10-6-5-9-14-11(10)13(18)20-16-8-4-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | VLDNLKJDINIIFA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|