C51H56N2O6 — CID 90891694
(2S)-1,1-bis(phenylmethoxy)butan-2-amine;9H-fluoren-9-ylmethyl N-[(2R)-1,1-bis(phenylmethoxy)butan-2-yl]carbamate (PubChem CID 90891694) has the molecular formula C51H56N2O6 and a molecular weight of 793.02 g/mol. Its IUPAC name is (2S)-1,1-bis(phenylmethoxy)butan-2-amine;9H-fluoren-9-ylmethyl N-[(2R)-1,1-bis(phenylmethoxy)butan-2-yl]carbamate.
| Compound Name | (2S)-1,1-bis(phenylmethoxy)butan-2-amine;9H-fluoren-9-ylmethyl N-[(2R)-1,1-bis(phenylmethoxy)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 90891694 |
| Molecular Formula | C51H56N2O6 |
| Molecular Weight | 793.02 g/mol |
| Exact Mass | 792.41 |
| IUPAC Name | (2S)-1,1-bis(phenylmethoxy)butan-2-amine;9H-fluoren-9-ylmethyl N-[(2R)-1,1-bis(phenylmethoxy)butan-2-yl]carbamate |
| SMILES | CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(OCc1ccccc1)OCc1ccccc1.CC[C@H](N)C(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H33NO4.C18H23NO2/c1-2-31(32(36-21-24-13-5-3-6-14-24)37-22-25-15-7-4-8-16-25)34-33(35)38-23-30-28-19-11-9-17-26(28)27-18-10-12-20-29(27)30;1-2-17(19)18(20-13-15-9-5-3-6-10-15)21-14-16-11-7-4-8-12-16/h3-20,30-32H,2,21-23H2,1H3,(H,34,35);3-12,17-18H,2,13-14,19H2,1H3/t31-;17-/m10/s1 |
| InChIKey | BKHMNLFYNWAWBP-QIIKODGJSA-N |
| XLogP | 10.55 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.02 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|