C28H29NO5 — CID 11633968
9H-fluoren-9-ylmethyl N-[(2S,3R)-1-hydroxy-3-[(4-methoxyphenyl)methoxy]pent-4-en-2-yl]carbamate (PubChem CID 11633968) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S,3R)-1-hydroxy-3-[(4-methoxyphenyl)methoxy]pent-4-en-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S,3R)-1-hydroxy-3-[(4-methoxyphenyl)methoxy]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 11633968 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S,3R)-1-hydroxy-3-[(4-methoxyphenyl)methoxy]pent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)[C@H](CO)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H29NO5/c1-3-27(33-17-19-12-14-20(32-2)15-13-19)26(16-30)29-28(31)34-18-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h3-15,25-27,30H,1,16-18H2,2H3,(H,29,31)/t26-,27+/m0/s1 |
| InChIKey | AGRZMCLJLJKARW-RRPNLBNLSA-N |
| XLogP | 4.67 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|