C11H15NO7 — CID 90892932
2-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl butanoate (PubChem CID 90892932) has the molecular formula C11H15NO7 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl butanoate.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl butanoate |
|---|---|
| PubChem CID | 90892932 |
| Molecular Formula | C11H15NO7 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl butanoate |
| SMILES | CCCC(=O)OCCOC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H15NO7/c1-2-3-10(15)17-6-7-18-11(16)19-12-8(13)4-5-9(12)14/h4-5,13-14H,2-3,6-7H2,1H3 |
| InChIKey | UPMRTXWAZDONGI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|