C15H22O3 — CID 90894172
methyl (1S,8aS)-3,6,6-trimethyl-4-oxo-1,4a,5,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 90894172) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (1S,8aS)-3,6,6-trimethyl-4-oxo-1,4a,5,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,8aS)-3,6,6-trimethyl-4-oxo-1,4a,5,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 90894172 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (1S,8aS)-3,6,6-trimethyl-4-oxo-1,4a,5,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C=C(C)C(=O)C2CC(C)(C)CC[C@@H]21 |
| InChI | InChI=1S/C15H22O3/c1-9-7-11(14(17)18-4)10-5-6-15(2,3)8-12(10)13(9)16/h7,10-12H,5-6,8H2,1-4H3/t10-,11-,12?/m1/s1 |
| InChIKey | HDDKZXKNQBOKQM-XFKKCKKNSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |